1-(4-{[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl}piperidin-1-yl)-2-phenylethan-1-one
Chemical Structure Depiction of
1-(4-{[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl}piperidin-1-yl)-2-phenylethan-1-one
1-(4-{[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl}piperidin-1-yl)-2-phenylethan-1-one
Compound characteristics
| Compound ID: | S339-0148 |
| Compound Name: | 1-(4-{[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl}piperidin-1-yl)-2-phenylethan-1-one |
| Molecular Weight: | 379.43 |
| Molecular Formula: | C22 H22 F N3 O2 |
| Smiles: | C1CN(CCC1Cc1nc(c2ccc(cc2)F)no1)C(Cc1ccccc1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7276 |
| logD: | 4.7276 |
| logSw: | -4.9242 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 47.431 |
| InChI Key: | SMCBWPYHUYGLPZ-UHFFFAOYSA-N |