2-(3,4-dimethoxyphenyl)-1-(4-{[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl}piperidin-1-yl)ethan-1-one
Chemical Structure Depiction of
2-(3,4-dimethoxyphenyl)-1-(4-{[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl}piperidin-1-yl)ethan-1-one
2-(3,4-dimethoxyphenyl)-1-(4-{[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl}piperidin-1-yl)ethan-1-one
Compound characteristics
| Compound ID: | S339-0149 |
| Compound Name: | 2-(3,4-dimethoxyphenyl)-1-(4-{[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]methyl}piperidin-1-yl)ethan-1-one |
| Molecular Weight: | 439.49 |
| Molecular Formula: | C24 H26 F N3 O4 |
| Smiles: | COc1ccc(CC(N2CCC(CC2)Cc2nc(c3ccc(cc3)F)no2)=O)cc1OC |
| Stereo: | ACHIRAL |
| logP: | 4.3461 |
| logD: | 4.3461 |
| logSw: | -4.4963 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 62.692 |
| InChI Key: | YMIDQZICHLCFOK-UHFFFAOYSA-N |