2-(4-chlorophenoxy)-1-{4-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]piperidin-1-yl}ethan-1-one
Chemical Structure Depiction of
2-(4-chlorophenoxy)-1-{4-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]piperidin-1-yl}ethan-1-one
2-(4-chlorophenoxy)-1-{4-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]piperidin-1-yl}ethan-1-one
Compound characteristics
| Compound ID: | S339-0743 |
| Compound Name: | 2-(4-chlorophenoxy)-1-{4-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]piperidin-1-yl}ethan-1-one |
| Molecular Weight: | 411.89 |
| Molecular Formula: | C22 H22 Cl N3 O3 |
| Smiles: | C1CN(CCC1Cc1nc(c2ccccc2)no1)C(COc1ccc(cc1)[Cl])=O |
| Stereo: | ACHIRAL |
| logP: | 4.69 |
| logD: | 4.69 |
| logSw: | -5.0204 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 54.93 |
| InChI Key: | UMVOHAZPRBJOBO-UHFFFAOYSA-N |