(1H-indol-3-yl)[3-(4-methylphenyl)-1-oxa-2,4,8-triazaspiro[4.5]dec-2-en-8-yl]methanone
Chemical Structure Depiction of
(1H-indol-3-yl)[3-(4-methylphenyl)-1-oxa-2,4,8-triazaspiro[4.5]dec-2-en-8-yl]methanone
(1H-indol-3-yl)[3-(4-methylphenyl)-1-oxa-2,4,8-triazaspiro[4.5]dec-2-en-8-yl]methanone
Compound characteristics
| Compound ID: | S340-0259 |
| Compound Name: | (1H-indol-3-yl)[3-(4-methylphenyl)-1-oxa-2,4,8-triazaspiro[4.5]dec-2-en-8-yl]methanone |
| Molecular Weight: | 374.44 |
| Molecular Formula: | C22 H22 N4 O2 |
| Smiles: | Cc1ccc(cc1)C1NC2(CCN(CC2)C(c2c[nH]c3ccccc23)=O)ON=1 |
| Stereo: | ACHIRAL |
| logP: | 3.3003 |
| logD: | 3.2873 |
| logSw: | -3.4608 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 62.211 |
| InChI Key: | URHWYGPSJLBWIP-UHFFFAOYSA-N |