(2-chlorophenyl)[3-(4-methylphenyl)-1-oxa-2,4,8-triazaspiro[4.5]dec-2-en-8-yl]methanone
Chemical Structure Depiction of
(2-chlorophenyl)[3-(4-methylphenyl)-1-oxa-2,4,8-triazaspiro[4.5]dec-2-en-8-yl]methanone
(2-chlorophenyl)[3-(4-methylphenyl)-1-oxa-2,4,8-triazaspiro[4.5]dec-2-en-8-yl]methanone
Compound characteristics
| Compound ID: | S340-0328 |
| Compound Name: | (2-chlorophenyl)[3-(4-methylphenyl)-1-oxa-2,4,8-triazaspiro[4.5]dec-2-en-8-yl]methanone |
| Molecular Weight: | 369.85 |
| Molecular Formula: | C20 H20 Cl N3 O2 |
| Smiles: | Cc1ccc(cc1)C1NC2(CCN(CC2)C(c2ccccc2[Cl])=O)ON=1 |
| Stereo: | ACHIRAL |
| logP: | 3.2219 |
| logD: | 3.2089 |
| logSw: | -3.8051 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.34 |
| InChI Key: | RTLFZIYNRZLLJY-UHFFFAOYSA-N |