N-[(2-chlorophenyl)methyl]-5-(4-fluorophenyl)-1,2,4-oxadiazole-3-carboxamide
Chemical Structure Depiction of
N-[(2-chlorophenyl)methyl]-5-(4-fluorophenyl)-1,2,4-oxadiazole-3-carboxamide
N-[(2-chlorophenyl)methyl]-5-(4-fluorophenyl)-1,2,4-oxadiazole-3-carboxamide
Compound characteristics
| Compound ID: | S341-0541 |
| Compound Name: | N-[(2-chlorophenyl)methyl]-5-(4-fluorophenyl)-1,2,4-oxadiazole-3-carboxamide |
| Molecular Weight: | 331.73 |
| Molecular Formula: | C16 H11 Cl F N3 O2 |
| Smiles: | C(c1ccccc1[Cl])NC(c1nc(c2ccc(cc2)F)on1)=O |
| Stereo: | ACHIRAL |
| logP: | 3.8824 |
| logD: | 3.8824 |
| logSw: | -4.3818 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.329 |
| InChI Key: | AXLMGNZMGKGFSW-UHFFFAOYSA-N |