N-[(3-methoxyphenyl)methyl]-5-(4-methylphenyl)-1,2,4-oxadiazole-3-carboxamide
Chemical Structure Depiction of
N-[(3-methoxyphenyl)methyl]-5-(4-methylphenyl)-1,2,4-oxadiazole-3-carboxamide
N-[(3-methoxyphenyl)methyl]-5-(4-methylphenyl)-1,2,4-oxadiazole-3-carboxamide
Compound characteristics
| Compound ID: | S341-0619 |
| Compound Name: | N-[(3-methoxyphenyl)methyl]-5-(4-methylphenyl)-1,2,4-oxadiazole-3-carboxamide |
| Molecular Weight: | 323.35 |
| Molecular Formula: | C18 H17 N3 O3 |
| Smiles: | Cc1ccc(cc1)c1nc(C(NCc2cccc(c2)OC)=O)no1 |
| Stereo: | ACHIRAL |
| logP: | 3.592 |
| logD: | 3.592 |
| logSw: | -3.7692 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 63.873 |
| InChI Key: | YBGCSQCMUFRHOR-UHFFFAOYSA-N |