N-[(2,4-difluorophenyl)methyl]-5-(4-methylphenyl)-1,2,4-oxadiazole-3-carboxamide
Chemical Structure Depiction of
N-[(2,4-difluorophenyl)methyl]-5-(4-methylphenyl)-1,2,4-oxadiazole-3-carboxamide
N-[(2,4-difluorophenyl)methyl]-5-(4-methylphenyl)-1,2,4-oxadiazole-3-carboxamide
Compound characteristics
| Compound ID: | S341-0633 |
| Compound Name: | N-[(2,4-difluorophenyl)methyl]-5-(4-methylphenyl)-1,2,4-oxadiazole-3-carboxamide |
| Molecular Weight: | 329.3 |
| Molecular Formula: | C17 H13 F2 N3 O2 |
| Smiles: | Cc1ccc(cc1)c1nc(C(NCc2ccc(cc2F)F)=O)no1 |
| Stereo: | ACHIRAL |
| logP: | 3.9085 |
| logD: | 3.9085 |
| logSw: | -3.9009 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.329 |
| InChI Key: | UIOBRYRPDBECPY-UHFFFAOYSA-N |