1-(3-chloro-4-fluorophenyl)-4-[5-(2,4-dimethylphenyl)-1,2,4-oxadiazol-3-yl]pyrrolidin-2-one
Chemical Structure Depiction of
1-(3-chloro-4-fluorophenyl)-4-[5-(2,4-dimethylphenyl)-1,2,4-oxadiazol-3-yl]pyrrolidin-2-one
1-(3-chloro-4-fluorophenyl)-4-[5-(2,4-dimethylphenyl)-1,2,4-oxadiazol-3-yl]pyrrolidin-2-one
Compound characteristics
| Compound ID: | S343-0216 |
| Compound Name: | 1-(3-chloro-4-fluorophenyl)-4-[5-(2,4-dimethylphenyl)-1,2,4-oxadiazol-3-yl]pyrrolidin-2-one |
| Molecular Weight: | 385.82 |
| Molecular Formula: | C20 H17 Cl F N3 O2 |
| Smiles: | Cc1ccc(c(C)c1)c1nc(C2CC(N(C2)c2ccc(c(c2)[Cl])F)=O)no1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.8242 |
| logD: | 4.8242 |
| logSw: | -4.8097 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 48.394 |
| InChI Key: | CBBBOYPRWOYJTG-CYBMUJFWSA-N |