4-{5-[3-(dimethylamino)phenyl]-1,2,4-oxadiazol-3-yl}-1-(4-fluorophenyl)pyrrolidin-2-one
Chemical Structure Depiction of
4-{5-[3-(dimethylamino)phenyl]-1,2,4-oxadiazol-3-yl}-1-(4-fluorophenyl)pyrrolidin-2-one
4-{5-[3-(dimethylamino)phenyl]-1,2,4-oxadiazol-3-yl}-1-(4-fluorophenyl)pyrrolidin-2-one
Compound characteristics
| Compound ID: | S343-0316 |
| Compound Name: | 4-{5-[3-(dimethylamino)phenyl]-1,2,4-oxadiazol-3-yl}-1-(4-fluorophenyl)pyrrolidin-2-one |
| Molecular Weight: | 366.39 |
| Molecular Formula: | C20 H19 F N4 O2 |
| Smiles: | CN(C)c1cccc(c1)c1nc(C2CC(N(C2)c2ccc(cc2)F)=O)no1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.7084 |
| logD: | 3.7076 |
| logSw: | -3.9569 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 51.199 |
| InChI Key: | PQEQFSNVLMEVOA-CQSZACIVSA-N |