1-(4-methylphenyl)-4-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]pyrrolidin-2-one
Chemical Structure Depiction of
1-(4-methylphenyl)-4-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]pyrrolidin-2-one
1-(4-methylphenyl)-4-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]pyrrolidin-2-one
Compound characteristics
| Compound ID: | S343-0615 |
| Compound Name: | 1-(4-methylphenyl)-4-[5-(4-methylphenyl)-1,2,4-oxadiazol-3-yl]pyrrolidin-2-one |
| Molecular Weight: | 333.39 |
| Molecular Formula: | C20 H19 N3 O2 |
| Smiles: | Cc1ccc(cc1)c1nc(C2CC(N(C2)c2ccc(C)cc2)=O)no1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.2888 |
| logD: | 4.2888 |
| logSw: | -4.2738 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 48.394 |
| InChI Key: | HMBNORGDPDEYPV-MRXNPFEDSA-N |