4-[5-(2,4-dimethylphenyl)-1,2,4-oxadiazol-3-yl]-1-[(2-methoxyphenyl)methyl]pyrrolidin-2-one
Chemical Structure Depiction of
4-[5-(2,4-dimethylphenyl)-1,2,4-oxadiazol-3-yl]-1-[(2-methoxyphenyl)methyl]pyrrolidin-2-one
4-[5-(2,4-dimethylphenyl)-1,2,4-oxadiazol-3-yl]-1-[(2-methoxyphenyl)methyl]pyrrolidin-2-one
Compound characteristics
| Compound ID: | S343-1118 |
| Compound Name: | 4-[5-(2,4-dimethylphenyl)-1,2,4-oxadiazol-3-yl]-1-[(2-methoxyphenyl)methyl]pyrrolidin-2-one |
| Molecular Weight: | 377.44 |
| Molecular Formula: | C22 H23 N3 O3 |
| Smiles: | Cc1ccc(c(C)c1)c1nc(C2CC(N(C2)Cc2ccccc2OC)=O)no1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.1284 |
| logD: | 4.1284 |
| logSw: | -4.2917 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 56.47 |
| InChI Key: | ZUDNFZMNBPTTGA-QGZVFWFLSA-N |