N-[3-(5,6,7,8-tetrahydro[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]cyclohexanecarboxamide
Chemical Structure Depiction of
N-[3-(5,6,7,8-tetrahydro[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]cyclohexanecarboxamide
N-[3-(5,6,7,8-tetrahydro[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]cyclohexanecarboxamide
Compound characteristics
| Compound ID: | S346-0141 |
| Compound Name: | N-[3-(5,6,7,8-tetrahydro[1,2,4]triazolo[4,3-a]pyridin-3-yl)phenyl]cyclohexanecarboxamide |
| Molecular Weight: | 324.42 |
| Molecular Formula: | C19 H24 N4 O |
| Smiles: | C1CCC(CC1)C(Nc1cccc(c1)c1nnc2CCCCn12)=O |
| Stereo: | ACHIRAL |
| logP: | 3.2741 |
| logD: | 3.2715 |
| logSw: | -3.384 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.215 |
| InChI Key: | BPSHEEPUDXRQAM-UHFFFAOYSA-N |