ethyl 3-oxo-2-{2-oxo-2-[2-(trifluoromethyl)anilino]ethyl}-3,5,7,8-tetrahydropyrido[4,3-c]pyridazine-6(2H)-carboxylate
Chemical Structure Depiction of
ethyl 3-oxo-2-{2-oxo-2-[2-(trifluoromethyl)anilino]ethyl}-3,5,7,8-tetrahydropyrido[4,3-c]pyridazine-6(2H)-carboxylate
ethyl 3-oxo-2-{2-oxo-2-[2-(trifluoromethyl)anilino]ethyl}-3,5,7,8-tetrahydropyrido[4,3-c]pyridazine-6(2H)-carboxylate
Compound characteristics
| Compound ID: | S349-0356 |
| Compound Name: | ethyl 3-oxo-2-{2-oxo-2-[2-(trifluoromethyl)anilino]ethyl}-3,5,7,8-tetrahydropyrido[4,3-c]pyridazine-6(2H)-carboxylate |
| Molecular Weight: | 424.38 |
| Molecular Formula: | C19 H19 F3 N4 O4 |
| Smiles: | CCOC(N1CCC2C(C1)=CC(N(CC(Nc1ccccc1C(F)(F)F)=O)N=2)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.1134 |
| logD: | 2.1134 |
| logSw: | -3.0738 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 73.398 |
| InChI Key: | QHEQDWXABZMOAX-UHFFFAOYSA-N |