2-[4-(2-chlorophenyl)-2,5-dioxo-3,4,5,7-tetrahydrofuro[3,4-d]pyrimidin-1(2H)-yl]-N-[2-(4-chlorophenyl)ethyl]acetamide
Chemical Structure Depiction of
2-[4-(2-chlorophenyl)-2,5-dioxo-3,4,5,7-tetrahydrofuro[3,4-d]pyrimidin-1(2H)-yl]-N-[2-(4-chlorophenyl)ethyl]acetamide
2-[4-(2-chlorophenyl)-2,5-dioxo-3,4,5,7-tetrahydrofuro[3,4-d]pyrimidin-1(2H)-yl]-N-[2-(4-chlorophenyl)ethyl]acetamide
Compound characteristics
| Compound ID: | S350-0364 |
| Compound Name: | 2-[4-(2-chlorophenyl)-2,5-dioxo-3,4,5,7-tetrahydrofuro[3,4-d]pyrimidin-1(2H)-yl]-N-[2-(4-chlorophenyl)ethyl]acetamide |
| Molecular Weight: | 460.32 |
| Molecular Formula: | C22 H19 Cl2 N3 O4 |
| Smiles: | C(CNC(CN1C2COC(C=2C(c2ccccc2[Cl])NC1=O)=O)=O)c1ccc(cc1)[Cl] |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.922 |
| logD: | 2.921 |
| logSw: | -3.4416 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 74.704 |
| InChI Key: | JMQDUMMQJJSDIN-HXUWFJFHSA-N |