2-[4-(2-ethoxyphenyl)-2,5-dioxo-3,4,5,7-tetrahydrofuro[3,4-d]pyrimidin-1(2H)-yl]-N-ethyl-N-phenylacetamide
Chemical Structure Depiction of
2-[4-(2-ethoxyphenyl)-2,5-dioxo-3,4,5,7-tetrahydrofuro[3,4-d]pyrimidin-1(2H)-yl]-N-ethyl-N-phenylacetamide
2-[4-(2-ethoxyphenyl)-2,5-dioxo-3,4,5,7-tetrahydrofuro[3,4-d]pyrimidin-1(2H)-yl]-N-ethyl-N-phenylacetamide
Compound characteristics
| Compound ID: | S350-0750 |
| Compound Name: | 2-[4-(2-ethoxyphenyl)-2,5-dioxo-3,4,5,7-tetrahydrofuro[3,4-d]pyrimidin-1(2H)-yl]-N-ethyl-N-phenylacetamide |
| Molecular Weight: | 435.48 |
| Molecular Formula: | C24 H25 N3 O5 |
| Smiles: | CCN(C(CN1C2COC(C=2C(c2ccccc2OCC)NC1=O)=O)=O)c1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.8925 |
| logD: | 2.8915 |
| logSw: | -3.3082 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 72.693 |
| InChI Key: | PKZQPAPVBRMXSN-QFIPXVFZSA-N |