N-[(4-ethylphenyl)methyl]-1-[6-(4-methylphenyl)-6,7-dihydro-4H-[1,2,3]triazolo[5,1-c][1,4]oxazine-3-carbonyl]piperidine-4-carboxamide
Chemical Structure Depiction of
N-[(4-ethylphenyl)methyl]-1-[6-(4-methylphenyl)-6,7-dihydro-4H-[1,2,3]triazolo[5,1-c][1,4]oxazine-3-carbonyl]piperidine-4-carboxamide
N-[(4-ethylphenyl)methyl]-1-[6-(4-methylphenyl)-6,7-dihydro-4H-[1,2,3]triazolo[5,1-c][1,4]oxazine-3-carbonyl]piperidine-4-carboxamide
Compound characteristics
| Compound ID: | S353-0548 |
| Compound Name: | N-[(4-ethylphenyl)methyl]-1-[6-(4-methylphenyl)-6,7-dihydro-4H-[1,2,3]triazolo[5,1-c][1,4]oxazine-3-carbonyl]piperidine-4-carboxamide |
| Molecular Weight: | 487.6 |
| Molecular Formula: | C28 H33 N5 O3 |
| Smiles: | CCc1ccc(CNC(C2CCN(CC2)C(c2c3COC(Cn3nn2)c2ccc(C)cc2)=O)=O)cc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.8855 |
| logD: | 2.8855 |
| logSw: | -2.9964 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 75.821 |
| InChI Key: | SUBLHKIRDOGFNB-RUZDIDTESA-N |