3-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]-6-(4-methoxyphenyl)-6,7-dihydro-4H-[1,2,3]triazolo[5,1-c][1,4]oxazine
Chemical Structure Depiction of
3-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]-6-(4-methoxyphenyl)-6,7-dihydro-4H-[1,2,3]triazolo[5,1-c][1,4]oxazine
3-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]-6-(4-methoxyphenyl)-6,7-dihydro-4H-[1,2,3]triazolo[5,1-c][1,4]oxazine
Compound characteristics
| Compound ID: | S354-0364 |
| Compound Name: | 3-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]-6-(4-methoxyphenyl)-6,7-dihydro-4H-[1,2,3]triazolo[5,1-c][1,4]oxazine |
| Molecular Weight: | 409.83 |
| Molecular Formula: | C20 H16 Cl N5 O3 |
| Smiles: | COc1ccc(cc1)C1Cn2c(CO1)c(c1nc(c3cccc(c3)[Cl])no1)nn2 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.9059 |
| logD: | 3.9059 |
| logSw: | -4.6013 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 73.709 |
| InChI Key: | CHCGJJGTZZOPTG-QGZVFWFLSA-N |