3-benzyl-3'-(4-methylphenyl)-5,5'-bi-1,2,4-oxadiazole
Chemical Structure Depiction of
3-benzyl-3'-(4-methylphenyl)-5,5'-bi-1,2,4-oxadiazole
3-benzyl-3'-(4-methylphenyl)-5,5'-bi-1,2,4-oxadiazole
Compound characteristics
| Compound ID: | S360-0192 |
| Compound Name: | 3-benzyl-3'-(4-methylphenyl)-5,5'-bi-1,2,4-oxadiazole |
| Molecular Weight: | 318.33 |
| Molecular Formula: | C18 H14 N4 O2 |
| Smiles: | Cc1ccc(cc1)c1nc(c2nc(Cc3ccccc3)no2)on1 |
| Stereo: | ACHIRAL |
| logP: | 4.5874 |
| logD: | 4.5874 |
| logSw: | -4.5669 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 64.312 |
| InChI Key: | SXKOZTMWWXZYGZ-UHFFFAOYSA-N |