3-(2H-1,3-benzodioxol-5-yl)-3'-[(3-fluorophenyl)methyl]-5,5'-bi-1,2,4-oxadiazole
Chemical Structure Depiction of
3-(2H-1,3-benzodioxol-5-yl)-3'-[(3-fluorophenyl)methyl]-5,5'-bi-1,2,4-oxadiazole
3-(2H-1,3-benzodioxol-5-yl)-3'-[(3-fluorophenyl)methyl]-5,5'-bi-1,2,4-oxadiazole
Compound characteristics
| Compound ID: | S360-0236 |
| Compound Name: | 3-(2H-1,3-benzodioxol-5-yl)-3'-[(3-fluorophenyl)methyl]-5,5'-bi-1,2,4-oxadiazole |
| Molecular Weight: | 366.31 |
| Molecular Formula: | C18 H11 F N4 O4 |
| Smiles: | C(c1cccc(c1)F)c1nc(c2nc(c3ccc4c(c3)OCO4)no2)on1 |
| Stereo: | ACHIRAL |
| logP: | 4.2523 |
| logD: | 4.2523 |
| logSw: | -4.6047 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 81.427 |
| InChI Key: | AABHPQZIUCKDSX-UHFFFAOYSA-N |