3-(2-ethoxyphenyl)-3'-ethyl-5,5'-bi-1,2,4-oxadiazole
Chemical Structure Depiction of
3-(2-ethoxyphenyl)-3'-ethyl-5,5'-bi-1,2,4-oxadiazole
3-(2-ethoxyphenyl)-3'-ethyl-5,5'-bi-1,2,4-oxadiazole
Compound characteristics
| Compound ID: | S360-1213 |
| Compound Name: | 3-(2-ethoxyphenyl)-3'-ethyl-5,5'-bi-1,2,4-oxadiazole |
| Molecular Weight: | 286.29 |
| Molecular Formula: | C14 H14 N4 O3 |
| Smiles: | CCc1nc(c2nc(c3ccccc3OCC)no2)on1 |
| Stereo: | ACHIRAL |
| logP: | 3.1152 |
| logD: | 3.1152 |
| logSw: | -3.2989 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 71.794 |
| InChI Key: | VWOKBPZODVTBTB-UHFFFAOYSA-N |