6-(2H-1,3-benzodioxol-5-yl)-N-[(4-methoxyphenyl)methyl]-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazine-2-carboxamide
Chemical Structure Depiction of
6-(2H-1,3-benzodioxol-5-yl)-N-[(4-methoxyphenyl)methyl]-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazine-2-carboxamide
6-(2H-1,3-benzodioxol-5-yl)-N-[(4-methoxyphenyl)methyl]-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazine-2-carboxamide
Compound characteristics
| Compound ID: | S368-1085 |
| Compound Name: | 6-(2H-1,3-benzodioxol-5-yl)-N-[(4-methoxyphenyl)methyl]-6,7-dihydro-4H-pyrazolo[5,1-c][1,4]oxazine-2-carboxamide |
| Molecular Weight: | 407.42 |
| Molecular Formula: | C22 H21 N3 O5 |
| Smiles: | COc1ccc(CNC(c2cc3COC(Cn3n2)c2ccc3c(c2)OCO3)=O)cc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.717 |
| logD: | 2.717 |
| logSw: | -3.1791 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 71.054 |
| InChI Key: | OMQOHHMVKUSTME-OAQYLSRUSA-N |