N-[(2-fluorophenyl)methyl]-4-[(1-oxo-7,8,9,10-tetrahydropyrazino[1,2-b]indazol-2(1H)-yl)methyl]benzamide
Chemical Structure Depiction of
N-[(2-fluorophenyl)methyl]-4-[(1-oxo-7,8,9,10-tetrahydropyrazino[1,2-b]indazol-2(1H)-yl)methyl]benzamide
N-[(2-fluorophenyl)methyl]-4-[(1-oxo-7,8,9,10-tetrahydropyrazino[1,2-b]indazol-2(1H)-yl)methyl]benzamide
Compound characteristics
| Compound ID: | S372-1430 |
| Compound Name: | N-[(2-fluorophenyl)methyl]-4-[(1-oxo-7,8,9,10-tetrahydropyrazino[1,2-b]indazol-2(1H)-yl)methyl]benzamide |
| Molecular Weight: | 430.48 |
| Molecular Formula: | C25 H23 F N4 O2 |
| Smiles: | C1CCc2c(C1)c1C(N(Cc3ccc(cc3)C(NCc3ccccc3F)=O)C=Cn1n2)=O |
| Stereo: | ACHIRAL |
| logP: | 2.7132 |
| logD: | 2.7132 |
| logSw: | -3.0412 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 53.853 |
| InChI Key: | RJNXDNFQHZQOIN-UHFFFAOYSA-N |