7-[2-(4-fluorophenoxy)ethyl]-1,3-dimethyl-1,3,7-triazaspiro[4.4]nonane-2,4-dione
Chemical Structure Depiction of
7-[2-(4-fluorophenoxy)ethyl]-1,3-dimethyl-1,3,7-triazaspiro[4.4]nonane-2,4-dione
7-[2-(4-fluorophenoxy)ethyl]-1,3-dimethyl-1,3,7-triazaspiro[4.4]nonane-2,4-dione
Compound characteristics
| Compound ID: | S382-1259 |
| Compound Name: | 7-[2-(4-fluorophenoxy)ethyl]-1,3-dimethyl-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
| Molecular Weight: | 321.35 |
| Molecular Formula: | C16 H20 F N3 O3 |
| Smiles: | CN1C(C2(CCN(CCOc3ccc(cc3)F)C2)N(C)C1=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.5295 |
| logD: | 0.3481 |
| logSw: | -1.8707 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 43.504 |
| InChI Key: | RNFFZNDVIFHOGL-INIZCTEOSA-N |