N-(3-chloro-4-fluorophenyl)-6-(4-methylphenyl)-6,7-dihydro-4H-[1,2,3]triazolo[5,1-c][1,4]oxazine-3-carboxamide
Chemical Structure Depiction of
N-(3-chloro-4-fluorophenyl)-6-(4-methylphenyl)-6,7-dihydro-4H-[1,2,3]triazolo[5,1-c][1,4]oxazine-3-carboxamide
N-(3-chloro-4-fluorophenyl)-6-(4-methylphenyl)-6,7-dihydro-4H-[1,2,3]triazolo[5,1-c][1,4]oxazine-3-carboxamide
Compound characteristics
| Compound ID: | S384-0713 |
| Compound Name: | N-(3-chloro-4-fluorophenyl)-6-(4-methylphenyl)-6,7-dihydro-4H-[1,2,3]triazolo[5,1-c][1,4]oxazine-3-carboxamide |
| Molecular Weight: | 386.81 |
| Molecular Formula: | C19 H16 Cl F N4 O2 |
| Smiles: | Cc1ccc(cc1)C1Cn2c(CO1)c(C(Nc1ccc(c(c1)[Cl])F)=O)nn2 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.5296 |
| logD: | 3.0788 |
| logSw: | -3.9103 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.851 |
| InChI Key: | DKMMTCLQNZLGTM-QGZVFWFLSA-N |