2-(2-chlorophenyl)-8-(2-phenoxypropanoyl)-1,2,4,8-tetraazaspiro[4.5]decan-3-one
Chemical Structure Depiction of
2-(2-chlorophenyl)-8-(2-phenoxypropanoyl)-1,2,4,8-tetraazaspiro[4.5]decan-3-one
2-(2-chlorophenyl)-8-(2-phenoxypropanoyl)-1,2,4,8-tetraazaspiro[4.5]decan-3-one
Compound characteristics
| Compound ID: | S388-0341 |
| Compound Name: | 2-(2-chlorophenyl)-8-(2-phenoxypropanoyl)-1,2,4,8-tetraazaspiro[4.5]decan-3-one |
| Molecular Weight: | 414.89 |
| Molecular Formula: | C21 H23 Cl N4 O3 |
| Smiles: | CC(C(N1CCC2(CC1)NC(N(c1ccccc1[Cl])N2)=O)=O)Oc1ccccc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.958 |
| logD: | 2.958 |
| logSw: | -3.4611 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 64 |
| InChI Key: | GVZWVYVSBQADLS-HNNXBMFYSA-N |