3-[(4-chlorophenyl)methyl]-8-(thiophene-3-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione
Chemical Structure Depiction of
3-[(4-chlorophenyl)methyl]-8-(thiophene-3-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione
3-[(4-chlorophenyl)methyl]-8-(thiophene-3-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione
Compound characteristics
| Compound ID: | S395-0028 |
| Compound Name: | 3-[(4-chlorophenyl)methyl]-8-(thiophene-3-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| Molecular Weight: | 403.89 |
| Molecular Formula: | C19 H18 Cl N3 O3 S |
| Smiles: | C1CN(CCC12C(N(Cc1ccc(cc1)[Cl])C(N2)=O)=O)C(c1ccsc1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.658 |
| logD: | 2.658 |
| logSw: | -3.6098 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.312 |
| InChI Key: | KICZTJDPBFIZGN-UHFFFAOYSA-N |