8-(2-chloro-4-fluorobenzoyl)-3-[(4-fluorophenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione
Chemical Structure Depiction of
8-(2-chloro-4-fluorobenzoyl)-3-[(4-fluorophenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione
8-(2-chloro-4-fluorobenzoyl)-3-[(4-fluorophenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione
Compound characteristics
| Compound ID: | S395-0926 |
| Compound Name: | 8-(2-chloro-4-fluorobenzoyl)-3-[(4-fluorophenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| Molecular Weight: | 433.84 |
| Molecular Formula: | C21 H18 Cl F2 N3 O3 |
| Smiles: | C1CN(CCC12C(N(Cc1ccc(cc1)F)C(N2)=O)=O)C(c1ccc(cc1[Cl])F)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9035 |
| logD: | 2.9035 |
| logSw: | -3.8271 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.293 |
| InChI Key: | SCWZNPWRNBNASJ-UHFFFAOYSA-N |