8-(2H-1,3-benzodioxole-5-carbonyl)-3-[(4-fluorophenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione
Chemical Structure Depiction of
8-(2H-1,3-benzodioxole-5-carbonyl)-3-[(4-fluorophenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione
8-(2H-1,3-benzodioxole-5-carbonyl)-3-[(4-fluorophenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione
Compound characteristics
| Compound ID: | S395-0989 |
| Compound Name: | 8-(2H-1,3-benzodioxole-5-carbonyl)-3-[(4-fluorophenyl)methyl]-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| Molecular Weight: | 425.42 |
| Molecular Formula: | C22 H20 F N3 O5 |
| Smiles: | C1CN(CCC12C(N(Cc1ccc(cc1)F)C(N2)=O)=O)C(c1ccc2c(c1)OCO2)=O |
| Stereo: | ACHIRAL |
| logP: | 2.1162 |
| logD: | 2.1162 |
| logSw: | -3.0502 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 75.409 |
| InChI Key: | MGISWSXFOHCJLX-UHFFFAOYSA-N |