N-(3,5-dimethoxyphenyl)-2-[1-(6-oxo-1,6-dihydropyridazin-4-yl)piperidin-3-yl]acetamide
Chemical Structure Depiction of
N-(3,5-dimethoxyphenyl)-2-[1-(6-oxo-1,6-dihydropyridazin-4-yl)piperidin-3-yl]acetamide
N-(3,5-dimethoxyphenyl)-2-[1-(6-oxo-1,6-dihydropyridazin-4-yl)piperidin-3-yl]acetamide
Compound characteristics
| Compound ID: | S396-0039 |
| Compound Name: | N-(3,5-dimethoxyphenyl)-2-[1-(6-oxo-1,6-dihydropyridazin-4-yl)piperidin-3-yl]acetamide |
| Molecular Weight: | 372.42 |
| Molecular Formula: | C19 H24 N4 O4 |
| Smiles: | COc1cc(cc(c1)OC)NC(CC1CCCN(C1)C1=CC(NN=C1)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.5377 |
| logD: | 2.4907 |
| logSw: | -2.8168 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 80.067 |
| InChI Key: | NHBVZMSFYBGASM-CYBMUJFWSA-N |