N-(2-ethoxyphenyl)-2-(2-oxo-3-phenyl-1,4-diazaspiro[4.6]undec-3-en-1-yl)acetamide
Chemical Structure Depiction of
N-(2-ethoxyphenyl)-2-(2-oxo-3-phenyl-1,4-diazaspiro[4.6]undec-3-en-1-yl)acetamide
N-(2-ethoxyphenyl)-2-(2-oxo-3-phenyl-1,4-diazaspiro[4.6]undec-3-en-1-yl)acetamide
Compound characteristics
| Compound ID: | S401-0414 |
| Compound Name: | N-(2-ethoxyphenyl)-2-(2-oxo-3-phenyl-1,4-diazaspiro[4.6]undec-3-en-1-yl)acetamide |
| Molecular Weight: | 419.52 |
| Molecular Formula: | C25 H29 N3 O3 |
| Smiles: | CCOc1ccccc1NC(CN1C(C(c2ccccc2)=NC12CCCCCC2)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.3579 |
| logD: | 4.3578 |
| logSw: | -4.1377 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.44 |
| InChI Key: | VEBYWMTZCCSPRR-UHFFFAOYSA-N |