5-[2-(4-fluorophenoxy)ethyl]-3-[3-(thiophen-3-yl)-1,2,4-oxadiazol-5-yl]-6,7-dihydro[1,2,3]triazolo[1,5-a]pyrazin-4(5H)-one
Chemical Structure Depiction of
5-[2-(4-fluorophenoxy)ethyl]-3-[3-(thiophen-3-yl)-1,2,4-oxadiazol-5-yl]-6,7-dihydro[1,2,3]triazolo[1,5-a]pyrazin-4(5H)-one
5-[2-(4-fluorophenoxy)ethyl]-3-[3-(thiophen-3-yl)-1,2,4-oxadiazol-5-yl]-6,7-dihydro[1,2,3]triazolo[1,5-a]pyrazin-4(5H)-one
Compound characteristics
| Compound ID: | S410-0874 |
| Compound Name: | 5-[2-(4-fluorophenoxy)ethyl]-3-[3-(thiophen-3-yl)-1,2,4-oxadiazol-5-yl]-6,7-dihydro[1,2,3]triazolo[1,5-a]pyrazin-4(5H)-one |
| Molecular Weight: | 426.43 |
| Molecular Formula: | C19 H15 F N6 O3 S |
| Smiles: | C1Cn2c(C(N1CCOc1ccc(cc1)F)=O)c(c1nc(c3ccsc3)no1)nn2 |
| Stereo: | ACHIRAL |
| logP: | 2.7444 |
| logD: | 2.7444 |
| logSw: | -2.9247 |
| Hydrogen bond acceptors count: | 8 |
| Polar surface area: | 82.649 |
| InChI Key: | PVCUOTTXVUYZRI-UHFFFAOYSA-N |