N-(4-cyanophenyl)-5-methyl-11-oxo-5,6,7,8,9,11-hexahydro-5aH-pyrido[2,1-b]quinazoline-3-carboxamide
					Chemical Structure Depiction of
N-(4-cyanophenyl)-5-methyl-11-oxo-5,6,7,8,9,11-hexahydro-5aH-pyrido[2,1-b]quinazoline-3-carboxamide
			N-(4-cyanophenyl)-5-methyl-11-oxo-5,6,7,8,9,11-hexahydro-5aH-pyrido[2,1-b]quinazoline-3-carboxamide
Compound characteristics
| Compound ID: | S420-0400 | 
| Compound Name: | N-(4-cyanophenyl)-5-methyl-11-oxo-5,6,7,8,9,11-hexahydro-5aH-pyrido[2,1-b]quinazoline-3-carboxamide | 
| Molecular Weight: | 360.41 | 
| Molecular Formula: | C21 H20 N4 O2 | 
| Smiles: | CN1C2CCCCN2C(c2ccc(cc12)C(Nc1ccc(C#N)cc1)=O)=O | 
| Stereo: | RACEMIC MIXTURE | 
| logP: | 2.409 | 
| logD: | 2.4086 | 
| logSw: | -3.1367 | 
| Hydrogen bond acceptors count: | 5 | 
| Hydrogen bond donors count: | 1 | 
| Polar surface area: | 58.436 | 
| InChI Key: | HYLSOEIRRKEFCH-IBGZPJMESA-N | 
 
				 
				