1-(2-ethoxy-7,8-dihydro-1,6-naphthyridin-6(5H)-yl)-3-methylbutan-1-one
Chemical Structure Depiction of
1-(2-ethoxy-7,8-dihydro-1,6-naphthyridin-6(5H)-yl)-3-methylbutan-1-one
1-(2-ethoxy-7,8-dihydro-1,6-naphthyridin-6(5H)-yl)-3-methylbutan-1-one
Compound characteristics
| Compound ID: | S422-0027 |
| Compound Name: | 1-(2-ethoxy-7,8-dihydro-1,6-naphthyridin-6(5H)-yl)-3-methylbutan-1-one |
| Molecular Weight: | 262.35 |
| Molecular Formula: | C15 H22 N2 O2 |
| Smiles: | CCOc1ccc2CN(CCc2n1)C(CC(C)C)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9927 |
| logD: | 2.9926 |
| logSw: | -3.0991 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 33.433 |
| InChI Key: | KPMHIFJVGOCMRJ-UHFFFAOYSA-N |