[4-(benzyloxy)-1-oxa-9-azaspiro[5.5]undecan-9-yl](2-methoxyphenyl)methanone
Chemical Structure Depiction of
[4-(benzyloxy)-1-oxa-9-azaspiro[5.5]undecan-9-yl](2-methoxyphenyl)methanone
[4-(benzyloxy)-1-oxa-9-azaspiro[5.5]undecan-9-yl](2-methoxyphenyl)methanone
Compound characteristics
| Compound ID: | S423-0436 |
| Compound Name: | [4-(benzyloxy)-1-oxa-9-azaspiro[5.5]undecan-9-yl](2-methoxyphenyl)methanone |
| Molecular Weight: | 395.5 |
| Molecular Formula: | C24 H29 N O4 |
| Smiles: | COc1ccccc1C(N1CCC2(CC1)CC(CCO2)OCc1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.9841 |
| logD: | 2.9841 |
| logSw: | -3.3699 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 37.861 |
| InChI Key: | BKZNQBNKWQSXHR-HXUWFJFHSA-N |