N-[(4-fluorophenyl)methyl]-2-(oxan-4-yl)acetamide
Chemical Structure Depiction of
N-[(4-fluorophenyl)methyl]-2-(oxan-4-yl)acetamide
N-[(4-fluorophenyl)methyl]-2-(oxan-4-yl)acetamide
Compound characteristics
| Compound ID: | S424-0062 |
| Compound Name: | N-[(4-fluorophenyl)methyl]-2-(oxan-4-yl)acetamide |
| Molecular Weight: | 251.3 |
| Molecular Formula: | C14 H18 F N O2 |
| Smiles: | C1COCCC1CC(NCc1ccc(cc1)F)=O |
| Stereo: | ACHIRAL |
| logP: | 1.9694 |
| logD: | 1.9694 |
| logSw: | -2.3411 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 32.539 |
| InChI Key: | CTLKSBLPRVBTHM-UHFFFAOYSA-N |