4-(2-ethoxyethoxy)-N-(3-methylphenyl)piperidine-1-carboxamide
Chemical Structure Depiction of
4-(2-ethoxyethoxy)-N-(3-methylphenyl)piperidine-1-carboxamide
4-(2-ethoxyethoxy)-N-(3-methylphenyl)piperidine-1-carboxamide
Compound characteristics
| Compound ID: | S425-0345 |
| Compound Name: | 4-(2-ethoxyethoxy)-N-(3-methylphenyl)piperidine-1-carboxamide |
| Molecular Weight: | 306.4 |
| Molecular Formula: | C17 H26 N2 O3 |
| Smiles: | CCOCCOC1CCN(CC1)C(Nc1cccc(C)c1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.313 |
| logD: | 2.313 |
| logSw: | -2.7769 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 40.617 |
| InChI Key: | JIEDNXSDWOYZDF-UHFFFAOYSA-N |