(2,5-difluorophenyl)[4-(2-phenoxyethoxy)piperidin-1-yl]methanone
Chemical Structure Depiction of
(2,5-difluorophenyl)[4-(2-phenoxyethoxy)piperidin-1-yl]methanone
(2,5-difluorophenyl)[4-(2-phenoxyethoxy)piperidin-1-yl]methanone
Compound characteristics
| Compound ID: | S425-0765 |
| Compound Name: | (2,5-difluorophenyl)[4-(2-phenoxyethoxy)piperidin-1-yl]methanone |
| Molecular Weight: | 361.39 |
| Molecular Formula: | C20 H21 F2 N O3 |
| Smiles: | C1CN(CCC1OCCOc1ccccc1)C(c1cc(ccc1F)F)=O |
| Stereo: | ACHIRAL |
| logP: | 3.3214 |
| logD: | 3.3214 |
| logSw: | -3.629 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 30.9645 |
| InChI Key: | WULYBVNWHCBMFJ-UHFFFAOYSA-N |