3-(2-{[1-(1,3,5-trimethyl-1H-pyrazole-4-sulfonyl)piperidin-4-yl]oxy}ethoxy)pyridine
Chemical Structure Depiction of
3-(2-{[1-(1,3,5-trimethyl-1H-pyrazole-4-sulfonyl)piperidin-4-yl]oxy}ethoxy)pyridine
3-(2-{[1-(1,3,5-trimethyl-1H-pyrazole-4-sulfonyl)piperidin-4-yl]oxy}ethoxy)pyridine
Compound characteristics
| Compound ID: | S425-0894 |
| Compound Name: | 3-(2-{[1-(1,3,5-trimethyl-1H-pyrazole-4-sulfonyl)piperidin-4-yl]oxy}ethoxy)pyridine |
| Molecular Weight: | 394.49 |
| Molecular Formula: | C18 H26 N4 O4 S |
| Smiles: | Cc1c(c(C)n(C)n1)S(N1CCC(CC1)OCCOc1cccnc1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 0.134 |
| logD: | 0.1333 |
| logSw: | -1.295 |
| Hydrogen bond acceptors count: | 9 |
| Polar surface area: | 70.384 |
| InChI Key: | WUWSZYBAOXABST-UHFFFAOYSA-N |