1-{3-[5-(ethoxymethyl)-1,2,4-oxadiazol-3-yl]piperidin-1-yl}-2-(4-methylphenyl)ethan-1-one
Chemical Structure Depiction of
1-{3-[5-(ethoxymethyl)-1,2,4-oxadiazol-3-yl]piperidin-1-yl}-2-(4-methylphenyl)ethan-1-one
1-{3-[5-(ethoxymethyl)-1,2,4-oxadiazol-3-yl]piperidin-1-yl}-2-(4-methylphenyl)ethan-1-one
Compound characteristics
| Compound ID: | S426-0243 |
| Compound Name: | 1-{3-[5-(ethoxymethyl)-1,2,4-oxadiazol-3-yl]piperidin-1-yl}-2-(4-methylphenyl)ethan-1-one |
| Molecular Weight: | 343.42 |
| Molecular Formula: | C19 H25 N3 O3 |
| Smiles: | CCOCc1nc(C2CCCN(C2)C(Cc2ccc(C)cc2)=O)no1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.8866 |
| logD: | 2.8866 |
| logSw: | -2.8784 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 55.694 |
| InChI Key: | QXMXPNIXKYHLGA-INIZCTEOSA-N |