1-(3-{5-[(2-fluorophenoxy)methyl]-1,2,4-oxadiazol-3-yl}piperidin-1-yl)-2-methoxyethan-1-one
Chemical Structure Depiction of
1-(3-{5-[(2-fluorophenoxy)methyl]-1,2,4-oxadiazol-3-yl}piperidin-1-yl)-2-methoxyethan-1-one
1-(3-{5-[(2-fluorophenoxy)methyl]-1,2,4-oxadiazol-3-yl}piperidin-1-yl)-2-methoxyethan-1-one
Compound characteristics
| Compound ID: | S426-0654 |
| Compound Name: | 1-(3-{5-[(2-fluorophenoxy)methyl]-1,2,4-oxadiazol-3-yl}piperidin-1-yl)-2-methoxyethan-1-one |
| Molecular Weight: | 349.36 |
| Molecular Formula: | C17 H20 F N3 O4 |
| Smiles: | COCC(N1CCCC(C1)c1nc(COc2ccccc2F)on1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.7258 |
| logD: | 1.7258 |
| logSw: | -1.9037 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 63.645 |
| InChI Key: | QBFVHDWPFYHKOJ-LBPRGKRZSA-N |