(3-{5-[(benzyloxy)methyl]-1,2,4-oxadiazol-3-yl}piperidin-1-yl)(4-methylphenyl)methanone
Chemical Structure Depiction of
(3-{5-[(benzyloxy)methyl]-1,2,4-oxadiazol-3-yl}piperidin-1-yl)(4-methylphenyl)methanone
(3-{5-[(benzyloxy)methyl]-1,2,4-oxadiazol-3-yl}piperidin-1-yl)(4-methylphenyl)methanone
Compound characteristics
| Compound ID: | S426-1028 |
| Compound Name: | (3-{5-[(benzyloxy)methyl]-1,2,4-oxadiazol-3-yl}piperidin-1-yl)(4-methylphenyl)methanone |
| Molecular Weight: | 391.47 |
| Molecular Formula: | C23 H25 N3 O3 |
| Smiles: | Cc1ccc(cc1)C(N1CCCC(C1)c1nc(COCc2ccccc2)on1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.8499 |
| logD: | 3.8499 |
| logSw: | -3.8906 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 56.326 |
| InChI Key: | KMRNGXYNKKMESN-FQEVSTJZSA-N |