(1,5-dimethyl-1H-pyrazol-3-yl){3-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl}methanone
Chemical Structure Depiction of
(1,5-dimethyl-1H-pyrazol-3-yl){3-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl}methanone
(1,5-dimethyl-1H-pyrazol-3-yl){3-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl}methanone
Compound characteristics
| Compound ID: | S428-0173 |
| Compound Name: | (1,5-dimethyl-1H-pyrazol-3-yl){3-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl}methanone |
| Molecular Weight: | 359.43 |
| Molecular Formula: | C18 H25 N5 O3 |
| Smiles: | Cc1cc(C(N2CCCC(C2)c2nc(C3CCOCC3)no2)=O)nn1C |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.669 |
| logD: | 1.669 |
| logSw: | -1.7383 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 70.813 |
| InChI Key: | KNOJTWOJKRFVQJ-AWEZNQCLSA-N |