(3-methoxyphenyl){3-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl}methanone
Chemical Structure Depiction of
(3-methoxyphenyl){3-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl}methanone
(3-methoxyphenyl){3-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl}methanone
Compound characteristics
| Compound ID: | S428-0238 |
| Compound Name: | (3-methoxyphenyl){3-[3-(oxan-4-yl)-1,2,4-oxadiazol-5-yl]piperidin-1-yl}methanone |
| Molecular Weight: | 371.43 |
| Molecular Formula: | C20 H25 N3 O4 |
| Smiles: | COc1cccc(c1)C(N1CCCC(C1)c1nc(C2CCOCC2)no1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.8292 |
| logD: | 2.8292 |
| logSw: | -3.0623 |
| Hydrogen bond acceptors count: | 7 |
| Polar surface area: | 63.87 |
| InChI Key: | ORMHRHNNMWENTF-INIZCTEOSA-N |