2-(4-fluorophenoxy)-1-[4-(pyrrolidin-1-yl)-1-oxa-9-azaspiro[5.5]undecan-9-yl]ethan-1-one
Chemical Structure Depiction of
2-(4-fluorophenoxy)-1-[4-(pyrrolidin-1-yl)-1-oxa-9-azaspiro[5.5]undecan-9-yl]ethan-1-one
2-(4-fluorophenoxy)-1-[4-(pyrrolidin-1-yl)-1-oxa-9-azaspiro[5.5]undecan-9-yl]ethan-1-one
Compound characteristics
| Compound ID: | S431-0428 |
| Compound Name: | 2-(4-fluorophenoxy)-1-[4-(pyrrolidin-1-yl)-1-oxa-9-azaspiro[5.5]undecan-9-yl]ethan-1-one |
| Molecular Weight: | 376.47 |
| Molecular Formula: | C21 H29 F N2 O3 |
| Smiles: | C1CCN(C1)C1CCOC2(CCN(CC2)C(COc2ccc(cc2)F)=O)C1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.8122 |
| logD: | -0.4321 |
| logSw: | -1.9949 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 33.92 |
| InChI Key: | ALOQUVYNZYQUTI-GOSISDBHSA-N |