(3,4-dimethoxyphenyl)[4-(pyrrolidin-1-yl)-1-oxa-9-azaspiro[5.5]undecan-9-yl]methanone
Chemical Structure Depiction of
(3,4-dimethoxyphenyl)[4-(pyrrolidin-1-yl)-1-oxa-9-azaspiro[5.5]undecan-9-yl]methanone
(3,4-dimethoxyphenyl)[4-(pyrrolidin-1-yl)-1-oxa-9-azaspiro[5.5]undecan-9-yl]methanone
Compound characteristics
| Compound ID: | S431-0480 |
| Compound Name: | (3,4-dimethoxyphenyl)[4-(pyrrolidin-1-yl)-1-oxa-9-azaspiro[5.5]undecan-9-yl]methanone |
| Molecular Weight: | 388.51 |
| Molecular Formula: | C22 H32 N2 O4 |
| Smiles: | COc1ccc(cc1OC)C(N1CCC2(CC1)CC(CCO2)N1CCCC1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.5421 |
| logD: | -0.7021 |
| logSw: | -1.9406 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 42.209 |
| InChI Key: | ZLDHWCPTQCPAHH-GOSISDBHSA-N |