9-benzyl-3-butanoyl-3,9-diazaspiro[5.6]dodecan-10-one
Chemical Structure Depiction of
9-benzyl-3-butanoyl-3,9-diazaspiro[5.6]dodecan-10-one
9-benzyl-3-butanoyl-3,9-diazaspiro[5.6]dodecan-10-one
Compound characteristics
| Compound ID: | S509-0672 |
| Compound Name: | 9-benzyl-3-butanoyl-3,9-diazaspiro[5.6]dodecan-10-one |
| Molecular Weight: | 342.48 |
| Molecular Formula: | C21 H30 N2 O2 |
| Smiles: | CCCC(N1CCC2(CCC(N(CC2)Cc2ccccc2)=O)CC1)=O |
| Stereo: | ACHIRAL |
| logP: | 2.3668 |
| logD: | 2.3668 |
| logSw: | -2.3766 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 33.587 |
| InChI Key: | MWPBOXODGWVRJU-UHFFFAOYSA-N |