N-(3-methylphenyl)-3-phenoxypyrrolidine-1-carboxamide
Chemical Structure Depiction of
N-(3-methylphenyl)-3-phenoxypyrrolidine-1-carboxamide
N-(3-methylphenyl)-3-phenoxypyrrolidine-1-carboxamide
Compound characteristics
| Compound ID: | S512-0053 |
| Compound Name: | N-(3-methylphenyl)-3-phenoxypyrrolidine-1-carboxamide |
| Molecular Weight: | 296.37 |
| Molecular Formula: | C18 H20 N2 O2 |
| Smiles: | Cc1cccc(c1)NC(N1CCC(C1)Oc1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.6379 |
| logD: | 3.6379 |
| logSw: | -3.7131 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 32.269 |
| InChI Key: | OQZLZBLLSWSSLA-QGZVFWFLSA-N |