(3-phenoxypyrrolidin-1-yl)(thiophen-2-yl)methanone
Chemical Structure Depiction of
(3-phenoxypyrrolidin-1-yl)(thiophen-2-yl)methanone
(3-phenoxypyrrolidin-1-yl)(thiophen-2-yl)methanone
Compound characteristics
| Compound ID: | S512-0111 |
| Compound Name: | (3-phenoxypyrrolidin-1-yl)(thiophen-2-yl)methanone |
| Molecular Weight: | 273.35 |
| Molecular Formula: | C15 H15 N O2 S |
| Smiles: | C1CN(CC1Oc1ccccc1)C(c1cccs1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.0164 |
| logD: | 3.0164 |
| logSw: | -3.0843 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 24.4661 |
| InChI Key: | JQSAMCBKAWSXOV-CYBMUJFWSA-N |