cyclopropyl(3-phenoxypyrrolidin-1-yl)methanone
Chemical Structure Depiction of
cyclopropyl(3-phenoxypyrrolidin-1-yl)methanone
cyclopropyl(3-phenoxypyrrolidin-1-yl)methanone
Compound characteristics
| Compound ID: | S512-0129 |
| Compound Name: | cyclopropyl(3-phenoxypyrrolidin-1-yl)methanone |
| Molecular Weight: | 231.29 |
| Molecular Formula: | C14 H17 N O2 |
| Smiles: | C1CN(CC1Oc1ccccc1)C(C1CC1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.3008 |
| logD: | 2.3008 |
| logSw: | -2.3301 |
| Hydrogen bond acceptors count: | 3 |
| Polar surface area: | 23.9709 |
| InChI Key: | HNXOAISZTSSDID-CYBMUJFWSA-N |